C20H29N5O3 — CID 147450184
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide (PubChem CID 147450184) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 147450184 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
| SMILES | [H]/N=C(\C=C/NC)NC(=O)c1cc(N2C[C@@H](C)O[C@@H](C)C2)nc2c1CCOCC2 |
| InChI | InChI=1S/C20H29N5O3/c1-13-11-25(12-14(2)28-13)19-10-16(20(26)24-18(21)4-7-22-3)15-5-8-27-9-6-17(15)23-19/h4,7,10,13-14,22H,5-6,8-9,11-12H2,1-3H3,(H2,21,24,26)/b7-4-/t13-,14+ |
| InChIKey | DXXGCCZAVROOTR-ISRGKOJGSA-N |
| XLogP | 1.25 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|