C21H26ClFN4O2 — CID 126617556
N-[(1Z,3E)-4-chloro-1-(methylideneamino)penta-1,3-dienyl]-2-[(3R)-3-fluoropiperidin-1-yl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide (PubChem CID 126617556) has the molecular formula C21H26ClFN4O2 and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[(1Z,3E)-4-chloro-1-(methylideneamino)penta-1,3-dienyl]-2-[(3R)-3-fluoropiperidin-1-yl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide.
| Compound Name | N-[(1Z,3E)-4-chloro-1-(methylideneamino)penta-1,3-dienyl]-2-[(3R)-3-fluoropiperidin-1-yl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 126617556 |
| Molecular Formula | C21H26ClFN4O2 |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(1Z,3E)-4-chloro-1-(methylideneamino)penta-1,3-dienyl]-2-[(3R)-3-fluoropiperidin-1-yl]-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
| SMILES | C=N/C(=C\C=C(/C)Cl)NC(=O)c1cc(N2CCC[C@@H](F)C2)nc2c1CCOCC2 |
| InChI | InChI=1S/C21H26ClFN4O2/c1-14(22)5-6-19(24-2)26-21(28)17-12-20(27-9-3-4-15(23)13-27)25-18-8-11-29-10-7-16(17)18/h5-6,12,15H,2-4,7-11,13H2,1H3,(H,26,28)/b14-5+,19-6+/t15-/m1/s1 |
| InChIKey | UELBEYXQRZTPAZ-KXYGJLHESA-N |
| XLogP | 3.55 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|