C12H27N3O2S — CID 145262265
N,N-dimethyl-2-[4-[3-(methylamino)propylamino]-4-oxobutyl]sulfanylethanamine oxide (PubChem CID 145262265) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[3-(methylamino)propylamino]-4-oxobutyl]sulfanylethanamine oxide.
| Compound Name | N,N-dimethyl-2-[4-[3-(methylamino)propylamino]-4-oxobutyl]sulfanylethanamine oxide |
|---|---|
| PubChem CID | 145262265 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N-dimethyl-2-[4-[3-(methylamino)propylamino]-4-oxobutyl]sulfanylethanamine oxide |
| SMILES | CNCCCNC(=O)CCCSCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C12H27N3O2S/c1-13-7-5-8-14-12(16)6-4-10-18-11-9-15(2,3)17/h13H,4-11H2,1-3H3,(H,14,16) |
| InChIKey | ZKPJUVXIFYZSAJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|