C20H42N3O2S+ — CID 159381192
3-[11-(3-amino-3-oxopropyl)sulfanylundecanoylamino]propyl-trimethylazanium (PubChem CID 159381192) has the molecular formula C20H42N3O2S+ and a molecular weight of 388.64 g/mol. Its IUPAC name is 3-[11-(3-amino-3-oxopropyl)sulfanylundecanoylamino]propyl-trimethylazanium.
| Compound Name | 3-[11-(3-amino-3-oxopropyl)sulfanylundecanoylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 159381192 |
| Molecular Formula | C20H42N3O2S+ |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 3-[11-(3-amino-3-oxopropyl)sulfanylundecanoylamino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNC(=O)CCCCCCCCCCSCCC(N)=O |
| InChI | InChI=1S/C20H41N3O2S/c1-23(2,3)16-12-15-22-20(25)13-10-8-6-4-5-7-9-11-17-26-18-14-19(21)24/h4-18H2,1-3H3,(H2-,21,22,24,25)/p+1 |
| InChIKey | GQWNTFXSHDWPMU-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|