C31H43NO4 — CID 145263302
2,2-dimethylbutanoic acid;3-[4-(2-methylbutan-2-yloxy)phenyl]-1-pentylquinolin-2-one (PubChem CID 145263302) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is 2,2-dimethylbutanoic acid;3-[4-(2-methylbutan-2-yloxy)phenyl]-1-pentylquinolin-2-one.
| Compound Name | 2,2-dimethylbutanoic acid;3-[4-(2-methylbutan-2-yloxy)phenyl]-1-pentylquinolin-2-one |
|---|---|
| PubChem CID | 145263302 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 2,2-dimethylbutanoic acid;3-[4-(2-methylbutan-2-yloxy)phenyl]-1-pentylquinolin-2-one |
| SMILES | CCC(C)(C)C(=O)O.CCCCCn1c(=O)c(-c2ccc(OC(C)(C)CC)cc2)cc2ccccc21 |
| InChI | InChI=1S/C25H31NO2.C6H12O2/c1-5-7-10-17-26-23-12-9-8-11-20(23)18-22(24(26)27)19-13-15-21(16-14-19)28-25(3,4)6-2;1-4-6(2,3)5(7)8/h8-9,11-16,18H,5-7,10,17H2,1-4H3;4H2,1-3H3,(H,7,8) |
| InChIKey | BRHQULPHVGTNQH-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|