About ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione
ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione (PubChem CID 145263299) has the molecular formula C23H27NO2S
and a molecular weight of 381.54 g/mol. Its IUPAC name is ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione.
Molecular Properties
| Compound Name | ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione |
| PubChem CID | 145263299 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione |
| SMILES | C=CO.CCC(C)(C)Oc1ccc(-c2cc3ccccc3n(C)c2=S)cc1 |
| InChI | InChI=1S/C21H23NOS.C2H4O/c1-5-21(2,3)23-17-12-10-15(11-13-17)18-14-16-8-6-7-9-19(16)22(4)20(18)24;1-2-3/h6-14H,5H2,1-4H3;2-3H,1H2 |
| InChIKey | BSAUUHRJYLUGJX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione?
The IUPAC name of ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione (CID 145263299) is ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione.
What is the SMILES notation for ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione?
The canonical SMILES for ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione is C=CO.CCC(C)(C)Oc1ccc(-c2cc3ccccc3n(C)c2=S)cc1.
What is the InChIKey of ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione?
The InChIKey is BSAUUHRJYLUGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NOS.C2H4O/c1-5-21(2,3)23-17-12-10-15(11-13-17)18-14-16-8-6-7-9-19(16)22(4)20(18)24;1-2-3/h6-14H,5H2,1-4H3;2-3H,1H2.
What are the key properties of ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione?
ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione has a molecular weight of 381.54 g/mol, XLogP of 6.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;1-methyl-3-[4-(2-methylbutan-2-yloxy)phenyl]quinoline-2-thione is sourced from PubChem (CID 145263299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).