C13H21NO — CID 145264159
(3Z,5E)-N-but-3-enyl-5-methoxy-2-methylidenehepta-3,5-dien-1-amine (PubChem CID 145264159) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (3Z,5E)-N-but-3-enyl-5-methoxy-2-methylidenehepta-3,5-dien-1-amine.
| Compound Name | (3Z,5E)-N-but-3-enyl-5-methoxy-2-methylidenehepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 145264159 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3Z,5E)-N-but-3-enyl-5-methoxy-2-methylidenehepta-3,5-dien-1-amine |
| SMILES | C=CCCNCC(=C)/C=C\C(=C/C)OC |
| InChI | InChI=1S/C13H21NO/c1-5-7-10-14-11-12(3)8-9-13(6-2)15-4/h5-6,8-9,14H,1,3,7,10-11H2,2,4H3/b9-8-,13-6+ |
| InChIKey | MPRWYKSYRXPJKN-GFBXJKNCSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|