C55H38N6O — CID 145265264
5-(2,6-diphenylpyrimidin-4-yl)-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,6b,10a-tetrahydro-[1]benzofuro[2,3-a]carbazole (PubChem CID 145265264) has the molecular formula C55H38N6O and a molecular weight of 798.95 g/mol. Its IUPAC name is 5-(2,6-diphenylpyrimidin-4-yl)-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,6b,10a-tetrahydro-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 5-(2,6-diphenylpyrimidin-4-yl)-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,6b,10a-tetrahydro-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 145265264 |
| Molecular Formula | C55H38N6O |
| Molecular Weight | 798.95 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | 5-(2,6-diphenylpyrimidin-4-yl)-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,6b,10a-tetrahydro-[1]benzofuro[2,3-a]carbazole |
| SMILES | C1=CC2Oc3c(cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c4c5c(n(-c6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6)c34)CCC=C5)C2C=C1 |
| InChI | InChI=1S/C55H38N6O/c1-5-18-35(19-6-1)45-34-46(57-52(56-45)36-20-7-2-8-21-36)44-33-43-41-28-14-16-31-48(41)62-51(43)50-49(44)42-29-13-15-30-47(42)61(50)40-27-17-26-39(32-40)55-59-53(37-22-9-3-10-23-37)58-54(60-55)38-24-11-4-12-25-38/h1-14,16-29,31-34,41,48H,15,30H2 |
| InChIKey | HEBXOSLLXBCIDB-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.95 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |