C57H41N5O — CID 145265210
5-[3-(9-cyclohexa-1,3-dien-1-ylcarbazol-2-yl)phenyl]-6-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7b,11a-dihydro-[1]benzofuro[3,2-c]carbazole (PubChem CID 145265210) has the molecular formula C57H41N5O and a molecular weight of 811.99 g/mol. Its IUPAC name is 5-[3-(9-cyclohexa-1,3-dien-1-ylcarbazol-2-yl)phenyl]-6-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7b,11a-dihydro-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 5-[3-(9-cyclohexa-1,3-dien-1-ylcarbazol-2-yl)phenyl]-6-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7b,11a-dihydro-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 145265210 |
| Molecular Formula | C57H41N5O |
| Molecular Weight | 811.99 g/mol |
| Exact Mass | 811.33 |
| IUPAC Name | 5-[3-(9-cyclohexa-1,3-dien-1-ylcarbazol-2-yl)phenyl]-6-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-7b,11a-dihydro-[1]benzofuro[3,2-c]carbazole |
| SMILES | C1=CCCC(n2c3ccccc3c3ccc(-c4cccc(-n5c6ccccc6c6c7c(cc(-c8nc(-c9ccccc9)nc(C9C=CC=CC9)n8)c65)C5C=CC=CC5O7)c4)cc32)=C1 |
| InChI | InChI=1S/C57H41N5O/c1-4-17-36(18-5-1)55-58-56(37-19-6-2-7-20-37)60-57(59-55)47-35-46-44-26-12-15-30-51(44)63-54(46)52-45-27-11-14-29-49(45)62(53(47)52)41-24-16-21-38(33-41)39-31-32-43-42-25-10-13-28-48(42)61(50(43)34-39)40-22-8-3-9-23-40/h1-8,10-19,21-22,24-35,37,44,51H,9,20,23H2 |
| InChIKey | SARZDQXGPTXPHO-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.99 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |