C63H41N5O2 — CID 156574749
11-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-6-dibenzofuran-2-yldibenzofuran-4-yl]-12-phenyl-9,10-dihydroindolo[2,3-a]carbazole (PubChem CID 156574749) has the molecular formula C63H41N5O2 and a molecular weight of 900.05 g/mol. Its IUPAC name is 11-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-6-dibenzofuran-2-yldibenzofuran-4-yl]-12-phenyl-9,10-dihydroindolo[2,3-a]carbazole.
| Compound Name | 11-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-6-dibenzofuran-2-yldibenzofuran-4-yl]-12-phenyl-9,10-dihydroindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 156574749 |
| Molecular Formula | C63H41N5O2 |
| Molecular Weight | 900.05 g/mol |
| Exact Mass | 899.33 |
| IUPAC Name | 11-[9-(4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-6-dibenzofuran-2-yldibenzofuran-4-yl]-12-phenyl-9,10-dihydroindolo[2,3-a]carbazole |
| SMILES | C1=CCC(c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5oc6ccccc6c5c4)c4oc5c(-n6c7c(c8ccc9c%10ccccc%10n(-c%10ccccc%10)c9c86)C=CCC7)cccc5c34)n2)C=C1 |
| InChI | InChI=1S/C63H41N5O2/c1-4-17-38(18-5-1)61-64-62(39-19-6-2-7-20-39)66-63(65-61)49-35-32-42(40-31-36-55-50(37-40)45-25-12-15-30-54(45)69-55)60-56(49)48-26-16-29-53(59(48)70-60)68-52-28-14-11-24-44(52)47-34-33-46-43-23-10-13-27-51(43)67(57(46)58(47)68)41-21-8-3-9-22-41/h1-13,15-19,21-27,29-37,39H,14,20,28H2 |
| InChIKey | CXKCWORMSDAUIH-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.05 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |