C45H30N4O — CID 170144355
7-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-1,2-dihydrocarbazole (PubChem CID 170144355) has the molecular formula C45H30N4O and a molecular weight of 642.76 g/mol. Its IUPAC name is 7-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-1,2-dihydrocarbazole.
| Compound Name | 7-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 170144355 |
| Molecular Formula | C45H30N4O |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 7-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-phenyl-1,2-dihydrocarbazole |
| SMILES | C1=Cc2c(n(-c3ccccc3)c3cc(-c4ccc5oc6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6c5c4)ccc23)CC1 |
| InChI | InChI=1S/C45H30N4O/c1-4-13-29(14-5-1)43-46-44(30-15-6-2-7-16-30)48-45(47-43)36-20-12-22-41-42(36)37-27-31(24-26-40(37)50-41)32-23-25-35-34-19-10-11-21-38(34)49(39(35)28-32)33-17-8-3-9-18-33/h1-10,12-20,22-28H,11,21H2 |
| InChIKey | MMDZOVFEYLGXGN-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |