C51H32N4OS — CID 170074157
9-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-3-yl]-1,2-dihydrocarbazole (PubChem CID 170074157) has the molecular formula C51H32N4OS and a molecular weight of 748.91 g/mol. Its IUPAC name is 9-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-3-yl]-1,2-dihydrocarbazole.
| Compound Name | 9-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-3-yl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 170074157 |
| Molecular Formula | C51H32N4OS |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.23 |
| IUPAC Name | 9-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-3-yl]-1,2-dihydrocarbazole |
| SMILES | C1=Cc2c(n(-c3ccc4c(c3)sc3ccc(-c5ccc6oc7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7c6c5)cc34)c3ccccc23)CC1 |
| InChI | InChI=1S/C51H32N4OS/c1-3-12-31(13-4-1)49-52-50(32-14-5-2-6-15-32)54-51(53-49)39-18-11-21-45-48(39)41-29-33(22-26-44(41)56-45)34-23-27-46-40(28-34)38-25-24-35(30-47(38)57-46)55-42-19-9-7-16-36(42)37-17-8-10-20-43(37)55/h1-9,11-19,21-30H,10,20H2 |
| InChIKey | JRYXXEMZVKLWPK-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |