C57H42N4O — CID 170282776
9-[9-[4-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-(4-cyclohexa-2,4-dien-1-ylphenyl)-1,3,5-triazin-2-yl]-5a,9a-dihydrodibenzofuran-3-yl]-2-phenylcarbazole (PubChem CID 170282776) has the molecular formula C57H42N4O and a molecular weight of 798.99 g/mol. Its IUPAC name is 9-[9-[4-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-(4-cyclohexa-2,4-dien-1-ylphenyl)-1,3,5-triazin-2-yl]-5a,9a-dihydrodibenzofuran-3-yl]-2-phenylcarbazole.
| Compound Name | 9-[9-[4-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-(4-cyclohexa-2,4-dien-1-ylphenyl)-1,3,5-triazin-2-yl]-5a,9a-dihydrodibenzofuran-3-yl]-2-phenylcarbazole |
|---|---|
| PubChem CID | 170282776 |
| Molecular Formula | C57H42N4O |
| Molecular Weight | 798.99 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | 9-[9-[4-(4-cyclohexa-1,5-dien-1-ylphenyl)-6-(4-cyclohexa-2,4-dien-1-ylphenyl)-1,3,5-triazin-2-yl]-5a,9a-dihydrodibenzofuran-3-yl]-2-phenylcarbazole |
| SMILES | C1=CCC(c2ccc(-c3nc(C4=CC=CC5Oc6cc(-n7c8ccccc8c8ccc(-c9ccccc9)cc87)ccc6C45)nc(-c4ccc(C5=CCCC=C5)cc4)n3)cc2)C=C1 |
| InChI | InChI=1S/C57H42N4O/c1-4-13-37(14-5-1)40-23-27-42(28-24-40)55-58-56(43-29-25-41(26-30-43)38-15-6-2-7-16-38)60-57(59-55)49-20-12-22-52-54(49)48-34-32-45(36-53(48)62-52)61-50-21-11-10-19-46(50)47-33-31-44(35-51(47)61)39-17-8-3-9-18-39/h1,3-6,8-13,15-37,52,54H,2,7,14H2 |
| InChIKey | SDKCSQFSRYSVDE-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.99 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |