C27H25Cl2N3O — CID 145265412
6-[bis(4-chlorophenyl)methyl]-4-(piperidin-4-ylamino)quinolin-8-ol (PubChem CID 145265412) has the molecular formula C27H25Cl2N3O and a molecular weight of 478.42 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-(piperidin-4-ylamino)quinolin-8-ol.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-(piperidin-4-ylamino)quinolin-8-ol |
|---|---|
| PubChem CID | 145265412 |
| Molecular Formula | C27H25Cl2N3O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-(piperidin-4-ylamino)quinolin-8-ol |
| SMILES | Oc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCNCC3)ccnc12 |
| InChI | InChI=1S/C27H25Cl2N3O/c28-20-5-1-17(2-6-20)26(18-3-7-21(29)8-4-18)19-15-23-24(32-22-9-12-30-13-10-22)11-14-31-27(23)25(33)16-19/h1-8,11,14-16,22,26,30,33H,9-10,12-13H2,(H,31,32) |
| InChIKey | QBEGNOMKMURTMC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|