C22H30N6O10 — CID 145265853
4-amino-2-butoxy-8-[[3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 145265853) has the molecular formula C22H30N6O10 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[[3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-[[3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 145265853 |
| Molecular Formula | C22H30N6O10 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 4-amino-2-butoxy-8-[[3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3C(O)(O)C(O)(O)C(O)(O)C3(O)O)c1)CC(=O)N2 |
| InChI | InChI=1S/C22H30N6O10/c1-2-3-7-38-18-25-16(23)15-17(26-18)27(11-14(29)24-15)9-12-5-4-6-13(8-12)10-28-21(34,35)19(30,31)20(32,33)22(28,36)37/h4-6,8,30-37H,2-3,7,9-11H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | DUVQFFXXWLDXHC-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 258.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|