C22H30N6O4 — CID 145265855
4-amino-2-(3,3-dihydroxybutoxy)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 145265855) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-amino-2-(3,3-dihydroxybutoxy)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-(3,3-dihydroxybutoxy)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 145265855 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-amino-2-(3,3-dihydroxybutoxy)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | CC(O)(O)CCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CCCC3)c1)CC(=O)N2 |
| InChI | InChI=1S/C22H30N6O4/c1-22(30,31)7-10-32-21-25-19(23)18-20(26-21)28(14-17(29)24-18)13-16-6-4-5-15(11-16)12-27-8-2-3-9-27/h4-6,11,30-31H,2-3,7-10,12-14H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | CDWKNTWRRMRCJU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|