C22H24ClFO4 — CID 145265878
(5-chloro-2-fluoro-4-phenylmethoxyphenyl)-cyclopentylmethanone;ethyl formate (PubChem CID 145265878) has the molecular formula C22H24ClFO4 and a molecular weight of 406.88 g/mol. Its IUPAC name is (5-chloro-2-fluoro-4-phenylmethoxyphenyl)-cyclopentylmethanone;ethyl formate.
| Compound Name | (5-chloro-2-fluoro-4-phenylmethoxyphenyl)-cyclopentylmethanone;ethyl formate |
|---|---|
| PubChem CID | 145265878 |
| Molecular Formula | C22H24ClFO4 |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (5-chloro-2-fluoro-4-phenylmethoxyphenyl)-cyclopentylmethanone;ethyl formate |
| SMILES | CCOC=O.O=C(c1cc(Cl)c(OCc2ccccc2)cc1F)C1CCCC1 |
| InChI | InChI=1S/C19H18ClFO2.C3H6O2/c20-16-10-15(19(22)14-8-4-5-9-14)17(21)11-18(16)23-12-13-6-2-1-3-7-13;1-2-5-3-4/h1-3,6-7,10-11,14H,4-5,8-9,12H2;3H,2H2,1H3 |
| InChIKey | PJIZBXFYZXLFIP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|