C14H27NO — CID 145266384
1-[(4,4,7-trimethyl-2-methylideneoct-7-enyl)amino]ethanol (PubChem CID 145266384) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-[(4,4,7-trimethyl-2-methylideneoct-7-enyl)amino]ethanol.
| Compound Name | 1-[(4,4,7-trimethyl-2-methylideneoct-7-enyl)amino]ethanol |
|---|---|
| PubChem CID | 145266384 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 1-[(4,4,7-trimethyl-2-methylideneoct-7-enyl)amino]ethanol |
| SMILES | C=C(C)CCC(C)(C)CC(=C)CNC(C)O |
| InChI | InChI=1S/C14H27NO/c1-11(2)7-8-14(5,6)9-12(3)10-15-13(4)16/h13,15-16H,1,3,7-10H2,2,4-6H3 |
| InChIKey | YVXNMDANMVBENA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|