C20H28FN3O3 — CID 145267444
butane;1-[(4-fluorophenyl)methyl]-5-methyl-6-oxopyridine-3-carboxamide;N-methylformamide (PubChem CID 145267444) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is butane;1-[(4-fluorophenyl)methyl]-5-methyl-6-oxopyridine-3-carboxamide;N-methylformamide.
| Compound Name | butane;1-[(4-fluorophenyl)methyl]-5-methyl-6-oxopyridine-3-carboxamide;N-methylformamide |
|---|---|
| PubChem CID | 145267444 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | butane;1-[(4-fluorophenyl)methyl]-5-methyl-6-oxopyridine-3-carboxamide;N-methylformamide |
| SMILES | CCCC.CNC=O.Cc1cc(C(N)=O)cn(Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C14H13FN2O2.C4H10.C2H5NO/c1-9-6-11(13(16)18)8-17(14(9)19)7-10-2-4-12(15)5-3-10;1-3-4-2;1-3-2-4/h2-6,8H,7H2,1H3,(H2,16,18);3-4H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | MLTPEFPLGZRAPZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|