C17H18N2O5 — CID 84570885
propyl 4-[(3-methyl-5-nitro-2-oxo-1-pyridinyl)methyl]benzoate (PubChem CID 84570885) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is propyl 4-[(3-methyl-5-nitro-2-oxo-1-pyridinyl)methyl]benzoate.
| Compound Name | propyl 4-[(3-methyl-5-nitro-2-oxo-1-pyridinyl)methyl]benzoate |
|---|---|
| PubChem CID | 84570885 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | propyl 4-[(3-methyl-5-nitro-2-oxo-1-pyridinyl)methyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(Cn2cc([N+](=O)[O-])cc(C)c2=O)cc1 |
| InChI | InChI=1S/C17H18N2O5/c1-3-8-24-17(21)14-6-4-13(5-7-14)10-18-11-15(19(22)23)9-12(2)16(18)20/h4-7,9,11H,3,8,10H2,1-2H3 |
| InChIKey | OZEKJKQHTQMVKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|