C13H10Cl2N2O3 — CID 84570353
1-[(2,6-dichlorophenyl)methyl]-3-methyl-5-nitropyridin-2-one (PubChem CID 84570353) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-3-methyl-5-nitropyridin-2-one.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-3-methyl-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 84570353 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3-methyl-5-nitropyridin-2-one |
| SMILES | Cc1cc([N+](=O)[O-])cn(Cc2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-8-5-9(17(19)20)6-16(13(8)18)7-10-11(14)3-2-4-12(10)15/h2-6H,7H2,1H3 |
| InChIKey | OTWFQGILKJLWGT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|