C17H14Cl2N2O2 — CID 151881025
2-[(2,6-dichlorophenyl)methyl]-1,4-dimethyl-6-nitroindole (PubChem CID 151881025) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]-1,4-dimethyl-6-nitroindole.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]-1,4-dimethyl-6-nitroindole |
|---|---|
| PubChem CID | 151881025 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]-1,4-dimethyl-6-nitroindole |
| SMILES | Cc1cc([N+](=O)[O-])cc2c1cc(Cc1c(Cl)cccc1Cl)n2C |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-10-6-12(21(22)23)9-17-13(10)7-11(20(17)2)8-14-15(18)4-3-5-16(14)19/h3-7,9H,8H2,1-2H3 |
| InChIKey | SOSHPSZPYZURQD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|