C30H23NO5 — CID 145268209
[6-[4-(4-hydroxybenzoyl)oxyphenyl]-7,8-dihydronaphthalen-2-yl] 4-aminobenzoate (PubChem CID 145268209) has the molecular formula C30H23NO5 and a molecular weight of 477.52 g/mol. Its IUPAC name is [6-[4-(4-hydroxybenzoyl)oxyphenyl]-7,8-dihydronaphthalen-2-yl] 4-aminobenzoate.
| Compound Name | [6-[4-(4-hydroxybenzoyl)oxyphenyl]-7,8-dihydronaphthalen-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 145268209 |
| Molecular Formula | C30H23NO5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [6-[4-(4-hydroxybenzoyl)oxyphenyl]-7,8-dihydronaphthalen-2-yl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)Oc2ccc3c(c2)CCC(c2ccc(OC(=O)c4ccc(O)cc4)cc2)=C3)cc1 |
| InChI | InChI=1S/C30H23NO5/c31-25-10-3-20(4-11-25)30(34)36-28-16-9-23-17-22(1-2-24(23)18-28)19-7-14-27(15-8-19)35-29(33)21-5-12-26(32)13-6-21/h3-18,32H,1-2,31H2 |
| InChIKey | LYCJNYGOUVRVBP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|