C19H32N4O4 — CID 145268915
tert-butyl N-cyclohexylcarbamate;2-morpholin-4-yl-1H-pyrimidin-6-one (PubChem CID 145268915) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl N-cyclohexylcarbamate;2-morpholin-4-yl-1H-pyrimidin-6-one.
| Compound Name | tert-butyl N-cyclohexylcarbamate;2-morpholin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145268915 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | tert-butyl N-cyclohexylcarbamate;2-morpholin-4-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1.O=c1ccnc(N2CCOCC2)[nH]1 |
| InChI | InChI=1S/C11H21NO2.C8H11N3O2/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;12-7-1-2-9-8(10-7)11-3-5-13-6-4-11/h9H,4-8H2,1-3H3,(H,12,13);1-2H,3-6H2,(H,9,10,12) |
| InChIKey | JJLPBJASYMLYPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |