C19H30N2O5 — CID 145268934
tert-butyl N-cyclohexylcarbamate;methyl 5-methoxypyridine-3-carboxylate (PubChem CID 145268934) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-cyclohexylcarbamate;methyl 5-methoxypyridine-3-carboxylate.
| Compound Name | tert-butyl N-cyclohexylcarbamate;methyl 5-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 145268934 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-cyclohexylcarbamate;methyl 5-methoxypyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1.COC(=O)c1cncc(OC)c1 |
| InChI | InChI=1S/C11H21NO2.C8H9NO3/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;1-11-7-3-6(4-9-5-7)8(10)12-2/h9H,4-8H2,1-3H3,(H,12,13);3-5H,1-2H3 |
| InChIKey | RROQPCRFOVOAPF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |