C23H29N5O2 — CID 145269176
2-amino-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide;cyclopentylmethoxymethylbenzene (PubChem CID 145269176) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-amino-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide;cyclopentylmethoxymethylbenzene.
| Compound Name | 2-amino-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide;cyclopentylmethoxymethylbenzene |
|---|---|
| PubChem CID | 145269176 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-amino-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide;cyclopentylmethoxymethylbenzene |
| SMILES | Cn1cc(-c2cnc(N)c(C(N)=O)c2)cn1.c1ccc(COCC2CCCC2)cc1 |
| InChI | InChI=1S/C13H18O.C10H11N5O/c1-2-6-12(7-3-1)10-14-11-13-8-4-5-9-13;1-15-5-7(4-14-15)6-2-8(10(12)16)9(11)13-3-6/h1-3,6-7,13H,4-5,8-11H2;2-5H,1H3,(H2,11,13)(H2,12,16) |
| InChIKey | LHFZZEDKDCOUBO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |