C24H31N5O2 — CID 145269284
cyclopentyloxymethylbenzene;2-(ethylamino)-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 145269284) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is cyclopentyloxymethylbenzene;2-(ethylamino)-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide.
| Compound Name | cyclopentyloxymethylbenzene;2-(ethylamino)-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145269284 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | cyclopentyloxymethylbenzene;2-(ethylamino)-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | CCNc1ncc(-c2cnn(C)c2)cc1C(N)=O.c1ccc(COC2CCCC2)cc1 |
| InChI | InChI=1S/C12H15N5O.C12H16O/c1-3-14-12-10(11(13)18)4-8(5-15-12)9-6-16-17(2)7-9;1-2-6-11(7-3-1)10-13-12-8-4-5-9-12/h4-7H,3H2,1-2H3,(H2,13,18)(H,14,15);1-3,6-7,12H,4-5,8-10H2 |
| InChIKey | JDBVTIFAIUKEHB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |