C14H21N3O2 — CID 145269273
5-(2,3-dihydropyridin-5-yl)-3-methylpyridin-2-amine;ethane;formic acid (PubChem CID 145269273) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-(2,3-dihydropyridin-5-yl)-3-methylpyridin-2-amine;ethane;formic acid.
| Compound Name | 5-(2,3-dihydropyridin-5-yl)-3-methylpyridin-2-amine;ethane;formic acid |
|---|---|
| PubChem CID | 145269273 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 5-(2,3-dihydropyridin-5-yl)-3-methylpyridin-2-amine;ethane;formic acid |
| SMILES | CC.Cc1cc(C2=CCCN=C2)cnc1N.O=CO |
| InChI | InChI=1S/C11H13N3.C2H6.CH2O2/c1-8-5-10(7-14-11(8)12)9-3-2-4-13-6-9;1-2;2-1-3/h3,5-7H,2,4H2,1H3,(H2,12,14);1-2H3;1H,(H,2,3) |
| InChIKey | JAHPMXVDJXLHQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|