About ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene
ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene (PubChem CID 145270486) has the molecular formula C21H35NO4
and a molecular weight of 365.51 g/mol. Its IUPAC name is ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene.
Molecular Properties
| Compound Name | ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene |
| PubChem CID | 145270486 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene |
| SMILES | C/C=C(\C)OC.CC.CCOC(=O)/C=C(/C)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19NO3.C5H10O.C2H6/c1-4-18-14(16)9-11(2)15-10-12-5-7-13(17-3)8-6-12;1-4-5(2)6-3;1-2/h5-9,15H,4,10H2,1-3H3;4H,1-3H3;1-2H3/b11-9-;5-4+; |
| InChIKey | JGOJGSJGIAVZKC-IGRCNVJRSA-N |
| XLogP | 4.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene?
The IUPAC name of ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene (CID 145270486) is ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene.
What is the SMILES notation for ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene?
The canonical SMILES for ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene is C/C=C(\C)OC.CC.CCOC(=O)/C=C(/C)NCc1ccc(OC)cc1.
What is the InChIKey of ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene?
The InChIKey is JGOJGSJGIAVZKC-IGRCNVJRSA-N. The full InChI is InChI=1S/C14H19NO3.C5H10O.C2H6/c1-4-18-14(16)9-11(2)15-10-12-5-7-13(17-3)8-6-12;1-4-5(2)6-3;1-2/h5-9,15H,4,10H2,1-3H3;4H,1-3H3;1-2H3/b11-9-;5-4+;.
What are the key properties of ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene?
ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene has a molecular weight of 365.51 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl (Z)-3-[(4-methoxyphenyl)methylamino]but-2-enoate;(E)-2-methoxybut-2-ene is sourced from PubChem (CID 145270486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).