C26H35N5O — CID 145275527
2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-1-methylimidazo[4,5-c]quinoline-8-carbonitrile;ethane;hexane (PubChem CID 145275527) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-1-methylimidazo[4,5-c]quinoline-8-carbonitrile;ethane;hexane.
| Compound Name | 2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-1-methylimidazo[4,5-c]quinoline-8-carbonitrile;ethane;hexane |
|---|---|
| PubChem CID | 145275527 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 2-[(2,5-dimethyl-1,3-oxazol-4-yl)methyl]-1-methylimidazo[4,5-c]quinoline-8-carbonitrile;ethane;hexane |
| SMILES | CC.CCCCCC.Cc1nc(Cc2nc3cnc4ccc(C#N)cc4c3n2C)c(C)o1 |
| InChI | InChI=1S/C18H15N5O.C6H14.C2H6/c1-10-15(21-11(2)24-10)7-17-22-16-9-20-14-5-4-12(8-19)6-13(14)18(16)23(17)3;1-3-5-6-4-2;1-2/h4-6,9H,7H2,1-3H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | PPFBFICQVQEJPR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|