C24H34ClN5 — CID 145275425
8-chloro-2-(1,2-dihydropyrazin-5-ylmethyl)-1-methylimidazo[4,5-c]quinoline;ethane;hexane (PubChem CID 145275425) has the molecular formula C24H34ClN5 and a molecular weight of 428.02 g/mol. Its IUPAC name is 8-chloro-2-(1,2-dihydropyrazin-5-ylmethyl)-1-methylimidazo[4,5-c]quinoline;ethane;hexane.
| Compound Name | 8-chloro-2-(1,2-dihydropyrazin-5-ylmethyl)-1-methylimidazo[4,5-c]quinoline;ethane;hexane |
|---|---|
| PubChem CID | 145275425 |
| Molecular Formula | C24H34ClN5 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 8-chloro-2-(1,2-dihydropyrazin-5-ylmethyl)-1-methylimidazo[4,5-c]quinoline;ethane;hexane |
| SMILES | CC.CCCCCC.Cn1c(CC2=CNCC=N2)nc2cnc3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C16H14ClN5.C6H14.C2H6/c1-22-15(7-11-8-18-4-5-19-11)21-14-9-20-13-3-2-10(17)6-12(13)16(14)22;1-3-5-6-4-2;1-2/h2-3,5-6,8-9,18H,4,7H2,1H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | SDQHYBGZNDPULB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|