C18H19ClF2N8 — CID 142423877
N'-[[8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyldiazenyl]ethanimidamide (PubChem CID 142423877) has the molecular formula C18H19ClF2N8 and a molecular weight of 420.86 g/mol. Its IUPAC name is N'-[[8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyldiazenyl]ethanimidamide.
| Compound Name | N'-[[8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyldiazenyl]ethanimidamide |
|---|---|
| PubChem CID | 142423877 |
| Molecular Formula | C18H19ClF2N8 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N'-[[8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyldiazenyl]ethanimidamide |
| SMILES | CC(N)=N/N=N/Cc1nc2cnc3ccc(Cl)cc3c2n1C1CN(C)CC1(F)F |
| InChI | InChI=1S/C18H19ClF2N8/c1-10(22)26-27-24-7-16-25-14-6-23-13-4-3-11(19)5-12(13)17(14)29(16)15-8-28(2)9-18(15,20)21/h3-6,15H,7-9H2,1-2H3,(H2,22,24,26) |
| InChIKey | GNHFUUCODNJXNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|