C19H21ClF2N7+ — CID 142423963
[8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyl-[(Z)-2-diazenylprop-1-enyl]azanium (PubChem CID 142423963) has the molecular formula C19H21ClF2N7+ and a molecular weight of 420.88 g/mol. Its IUPAC name is [8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyl-[(Z)-2-diazenylprop-1-enyl]azanium.
| Compound Name | [8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyl-[(Z)-2-diazenylprop-1-enyl]azanium |
|---|---|
| PubChem CID | 142423963 |
| Molecular Formula | C19H21ClF2N7+ |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [8-chloro-1-(4,4-difluoro-1-methylpyrrolidin-3-yl)imidazo[4,5-c]quinolin-2-yl]methyl-[(Z)-2-diazenylprop-1-enyl]azanium |
| SMILES | [H]/N=N/C(C)=C\[NH2+]Cc1nc2cnc3ccc(Cl)cc3c2n1C1CN(C)CC1(F)F |
| InChI | InChI=1S/C19H20ClF2N7/c1-11(27-23)6-24-8-17-26-15-7-25-14-4-3-12(20)5-13(14)18(15)29(17)16-9-28(2)10-19(16,21)22/h3-7,16,23-24H,8-10H2,1-2H3/p+1/b11-6-,27-23+ |
| InChIKey | LEGVILRSRCHRHB-DNIHMRGQSA-O |
| XLogP | 3.32 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|