About ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate
ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate (PubChem CID 145277131) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate |
| PubChem CID | 145277131 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate |
| SMILES | C=C.CC.Cc1ccc2[nH]c(C(=O)OF)cc2c1 |
| InChI | InChI=1S/C10H8FNO2.C2H6.C2H4/c1-6-2-3-8-7(4-6)5-9(12-8)10(13)14-11;2*1-2/h2-5,12H,1H3;1-2H3;1-2H2 |
| InChIKey | XSGMEAPSUGRONW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate?
The IUPAC name of ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate (CID 145277131) is ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate.
What is the SMILES notation for ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate?
The canonical SMILES for ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate is C=C.CC.Cc1ccc2[nH]c(C(=O)OF)cc2c1.
What is the InChIKey of ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate?
The InChIKey is XSGMEAPSUGRONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO2.C2H6.C2H4/c1-6-2-3-8-7(4-6)5-9(12-8)10(13)14-11;2*1-2/h2-5,12H,1H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate?
ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate has a molecular weight of 251.30 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;fluoro 5-methyl-1H-indole-2-carboxylate is sourced from PubChem (CID 145277131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).