About CID 145278706
CID 145278706 (PubChem CID 145278706) has the molecular formula C9H8BN
and a molecular weight of 140.98 g/mol.
Molecular Properties
| Compound Name | CID 145278706 |
| PubChem CID | 145278706 |
| Molecular Formula | C9H8BN |
| Molecular Weight | 140.98 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2[nH]ccc2c1C |
| InChI | InChI=1S/C9H8BN/c1-6-7-4-5-11-9(7)3-2-8(6)10/h2-5,11H,1H3 |
| InChIKey | NFRMNXBUZQWIFU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.98 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145278706 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145278706?
The IUPAC name of CID 145278706 (CID 145278706) is not available.
What is the SMILES notation for CID 145278706?
The canonical SMILES for CID 145278706 is [B]c1ccc2[nH]ccc2c1C.
What is the InChIKey of CID 145278706?
The InChIKey is NFRMNXBUZQWIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BN/c1-6-7-4-5-11-9(7)3-2-8(6)10/h2-5,11H,1H3.
What are the key properties of CID 145278706?
CID 145278706 has a molecular weight of 140.98 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145278706 is sourced from PubChem (CID 145278706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).