C15H14FNO2 — CID 145278712
3,4-bis(ethenyl)-1-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]pyrrole-2,5-dione (PubChem CID 145278712) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]pyrrole-2,5-dione.
| Compound Name | 3,4-bis(ethenyl)-1-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145278712 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3,4-bis(ethenyl)-1-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]pyrrole-2,5-dione |
| SMILES | C=CC1=C(C=C)C(=O)N(C/C(C=C)=C/C(=C)F)C1=O |
| InChI | InChI=1S/C15H14FNO2/c1-5-11(8-10(4)16)9-17-14(18)12(6-2)13(7-3)15(17)19/h5-8H,1-4,9H2/b11-8+ |
| InChIKey | PJJWKTTVFARXHT-DHZHZOJOSA-N |
| XLogP | 2.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|