C8H10FNO — CID 142390297
4-(1-fluoroethenyl)-1,3-dimethyl-2H-pyrrol-5-one (PubChem CID 142390297) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is 4-(1-fluoroethenyl)-1,3-dimethyl-2H-pyrrol-5-one.
| Compound Name | 4-(1-fluoroethenyl)-1,3-dimethyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 142390297 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4-(1-fluoroethenyl)-1,3-dimethyl-2H-pyrrol-5-one |
| SMILES | C=C(F)C1=C(C)CN(C)C1=O |
| InChI | InChI=1S/C8H10FNO/c1-5-4-10(3)8(11)7(5)6(2)9/h2,4H2,1,3H3 |
| InChIKey | ADCMJSGVZYDUHP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |