C15H24F3NO — CID 100938448
(2Z)-N,N-dibutyl-3-methyl-2-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 100938448) has the molecular formula C15H24F3NO and a molecular weight of 291.36 g/mol. Its IUPAC name is (2Z)-N,N-dibutyl-3-methyl-2-(trifluoromethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-N,N-dibutyl-3-methyl-2-(trifluoromethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 100938448 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2Z)-N,N-dibutyl-3-methyl-2-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | C=C/C(C)=C(/C(=O)N(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C15H24F3NO/c1-5-8-10-19(11-9-6-2)14(20)13(12(4)7-3)15(16,17)18/h7H,3,5-6,8-11H2,1-2,4H3/b13-12- |
| InChIKey | ARAULBSRTVCLHT-SEYXRHQNSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|