C12H14F2NOY- — CID 59861796
N,N-diethyl-2,5-difluoro-3-methylbenzene-4-ide-1-carboxamide;yttrium (PubChem CID 59861796) has the molecular formula C12H14F2NOY- and a molecular weight of 315.15 g/mol. Its IUPAC name is N,N-diethyl-2,5-difluoro-3-methylbenzene-4-ide-1-carboxamide;yttrium.
| Compound Name | N,N-diethyl-2,5-difluoro-3-methylbenzene-4-ide-1-carboxamide;yttrium |
|---|---|
| PubChem CID | 59861796 |
| Molecular Formula | C12H14F2NOY- |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N,N-diethyl-2,5-difluoro-3-methylbenzene-4-ide-1-carboxamide;yttrium |
| SMILES | CCN(CC)C(=O)c1cc(F)[c-]c(C)c1F.[Y] |
| InChI | InChI=1S/C12H14F2NO.Y/c1-4-15(5-2)12(16)10-7-9(13)6-8(3)11(10)14;/h7H,4-5H2,1-3H3;/q-1; |
| InChIKey | XHDDIZFBXZXLJU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|