C19H20N2O4 — CID 145279050
formaldehyde;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one (PubChem CID 145279050) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is formaldehyde;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one.
| Compound Name | formaldehyde;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one |
|---|---|
| PubChem CID | 145279050 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | formaldehyde;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one |
| SMILES | C=O.CNc1cc(N(C)c2cc(=O)oc3ccccc23)ccc1OC |
| InChI | InChI=1S/C18H18N2O3.CH2O/c1-19-14-10-12(8-9-17(14)22-3)20(2)15-11-18(21)23-16-7-5-4-6-13(15)16;1-2/h4-11,19H,1-3H3;1H2 |
| InChIKey | ZBBIIXLDWIGUSU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|