C25H32N2O6 — CID 145279080
methoxymethane;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one;pentanedial (PubChem CID 145279080) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is methoxymethane;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one;pentanedial.
| Compound Name | methoxymethane;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one;pentanedial |
|---|---|
| PubChem CID | 145279080 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methoxymethane;4-[4-methoxy-N-methyl-3-(methylamino)anilino]chromen-2-one;pentanedial |
| SMILES | CNc1cc(N(C)c2cc(=O)oc3ccccc23)ccc1OC.COC.O=CCCCC=O |
| InChI | InChI=1S/C18H18N2O3.C5H8O2.C2H6O/c1-19-14-10-12(8-9-17(14)22-3)20(2)15-11-18(21)23-16-7-5-4-6-13(15)16;6-4-2-1-3-5-7;1-3-2/h4-11,19H,1-3H3;4-5H,1-3H2;1-2H3 |
| InChIKey | JDUGEYWLPPZLTR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|