C30H33N3O6S — CID 175389088
N-[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide (PubChem CID 175389088) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is N-[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide.
| Compound Name | N-[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 175389088 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
| SMILES | COc1ccc(N(C)c2cc(=O)oc3ccccc23)cc1NC(=O)C(CC(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H33N3O6S/c1-19(2)16-25(32-40(36,37)22-13-10-20(3)11-14-22)30(35)31-24-17-21(12-15-28(24)38-5)33(4)26-18-29(34)39-27-9-7-6-8-23(26)27/h6-15,17-19,25,32H,16H2,1-5H3,(H,31,35) |
| InChIKey | JKXABSPIVKAGQX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|