C29H46O2 — CID 145280152
(3aR,9aS)-3-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-3a-hydroxy-6,6,9a-trimethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 145280152) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (3aR,9aS)-3-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-3a-hydroxy-6,6,9a-trimethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | (3aR,9aS)-3-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-3a-hydroxy-6,6,9a-trimethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 145280152 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (3aR,9aS)-3-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-3a-hydroxy-6,6,9a-trimethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)C1CCC2[C@@]3(C)CCC(=O)C(C)(C)C3CC[C@@]12O |
| InChI | InChI=1S/C29H46O2/c1-20(2)10-8-11-21(3)12-9-13-22(4)23-14-15-25-28(7)18-17-26(30)27(5,6)24(28)16-19-29(23,25)31/h10,12,23-25,31H,4,8-9,11,13-19H2,1-3,5-7H3/b21-12+/t23?,24?,25?,28-,29+/m0/s1 |
| InChIKey | NFZXONZMFFADPT-ZQEKOWNGSA-N |
| XLogP | 7.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|