C30H48O — CID 162944488
3-(6,10-dimethylundeca-1,5,9-trien-2-yl)-3a,6,6,9a-tetramethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 162944488) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is 3-(6,10-dimethylundeca-1,5,9-trien-2-yl)-3a,6,6,9a-tetramethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | 3-(6,10-dimethylundeca-1,5,9-trien-2-yl)-3a,6,6,9a-tetramethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 162944488 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | 3-(6,10-dimethylundeca-1,5,9-trien-2-yl)-3a,6,6,9a-tetramethyl-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | C=C(CCC=C(C)CCC=C(C)C)C1CCC2C1(C)CCC1C(C)(C)C(=O)CCC12C |
| InChI | InChI=1S/C30H48O/c1-21(2)11-9-12-22(3)13-10-14-23(4)24-15-16-26-29(24,7)19-17-25-28(5,6)27(31)18-20-30(25,26)8/h11,13,24-26H,4,9-10,12,14-20H2,1-3,5-8H3 |
| InChIKey | HIDTXJNTPPZHEX-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|