C37H27F3N2 — CID 145280805
[6a-methyl-9-(6-methylcyclohexa-2,4-dien-1-yl)-7-phenyl-4-[4-(trifluoromethyl)phenyl]-6H-cyclopenta[a]acenaphthylen-8-ylidene]cyanamide (PubChem CID 145280805) has the molecular formula C37H27F3N2 and a molecular weight of 556.63 g/mol. Its IUPAC name is [6a-methyl-9-(6-methylcyclohexa-2,4-dien-1-yl)-7-phenyl-4-[4-(trifluoromethyl)phenyl]-6H-cyclopenta[a]acenaphthylen-8-ylidene]cyanamide.
| Compound Name | [6a-methyl-9-(6-methylcyclohexa-2,4-dien-1-yl)-7-phenyl-4-[4-(trifluoromethyl)phenyl]-6H-cyclopenta[a]acenaphthylen-8-ylidene]cyanamide |
|---|---|
| PubChem CID | 145280805 |
| Molecular Formula | C37H27F3N2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [6a-methyl-9-(6-methylcyclohexa-2,4-dien-1-yl)-7-phenyl-4-[4-(trifluoromethyl)phenyl]-6H-cyclopenta[a]acenaphthylen-8-ylidene]cyanamide |
| SMILES | CC1C=CC=CC1C1=C2C(=C(c3ccccc3)/C1=N/C#N)C1(C)CC=C(c3ccc(C(F)(F)F)cc3)c3cccc2c31 |
| InChI | InChI=1S/C37H27F3N2/c1-22-9-6-7-12-26(22)32-31-29-14-8-13-28-27(23-15-17-25(18-16-23)37(38,39)40)19-20-36(2,33(28)29)34(31)30(35(32)42-21-41)24-10-4-3-5-11-24/h3-19,22,26H,20H2,1-2H3/b42-35- |
| InChIKey | MARCFUVYESHZKB-LLRJKHIDSA-N |
| XLogP | 9.33 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|