C35H47N5O4S2 — CID 145281792
N-[(4R)-4-[(4-aminophenyl)sulfanylcarbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[1-ethoxy-4-methyl-3-[methyl(pentanoyl)amino]pentyl]-1,3-thiazole-4-carboxamide (PubChem CID 145281792) has the molecular formula C35H47N5O4S2 and a molecular weight of 665.93 g/mol. Its IUPAC name is N-[(4R)-4-[(4-aminophenyl)sulfanylcarbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[1-ethoxy-4-methyl-3-[methyl(pentanoyl)amino]pentyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4R)-4-[(4-aminophenyl)sulfanylcarbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[1-ethoxy-4-methyl-3-[methyl(pentanoyl)amino]pentyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 145281792 |
| Molecular Formula | C35H47N5O4S2 |
| Molecular Weight | 665.93 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | N-[(4R)-4-[(4-aminophenyl)sulfanylcarbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[1-ethoxy-4-methyl-3-[methyl(pentanoyl)amino]pentyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCC(=O)N(C)C(CC(OCC)c1nc(C(=O)NC2Cc3ccccc3[C@H](C(=O)NSc3ccc(N)cc3)C2)cs1)C(C)C |
| InChI | InChI=1S/C35H47N5O4S2/c1-6-8-13-32(41)40(5)30(22(3)4)20-31(44-7-2)35-38-29(21-45-35)34(43)37-25-18-23-11-9-10-12-27(23)28(19-25)33(42)39-46-26-16-14-24(36)15-17-26/h9-12,14-17,21-22,25,28,30-31H,6-8,13,18-20,36H2,1-5H3,(H,37,43)(H,39,42)/t25?,28-,30?,31?/m1/s1 |
| InChIKey | VGGYKILYBXIAAZ-HRLVRPAQSA-N |
| XLogP | 6.52 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.93 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|