C19H22N4 — CID 145283578
5,5-diethyl-7-methyl-6-methylidene-6aH-purino[9,8-a]quinoline (PubChem CID 145283578) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 5,5-diethyl-7-methyl-6-methylidene-6aH-purino[9,8-a]quinoline.
| Compound Name | 5,5-diethyl-7-methyl-6-methylidene-6aH-purino[9,8-a]quinoline |
|---|---|
| PubChem CID | 145283578 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5,5-diethyl-7-methyl-6-methylidene-6aH-purino[9,8-a]quinoline |
| SMILES | C=C1C2N(C)c3cncnc3N2c2ccccc2C1(CC)CC |
| InChI | InChI=1S/C19H22N4/c1-5-19(6-2)13(3)18-22(4)16-11-20-12-21-17(16)23(18)15-10-8-7-9-14(15)19/h7-12,18H,3,5-6H2,1-2,4H3 |
| InChIKey | JDKUPJDTLXUIPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|