C19H24N4 — CID 146532702
8,9,10,10,12-pentamethyl-1,12,15,17-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaene (PubChem CID 146532702) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 8,9,10,10,12-pentamethyl-1,12,15,17-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaene.
| Compound Name | 8,9,10,10,12-pentamethyl-1,12,15,17-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaene |
|---|---|
| PubChem CID | 146532702 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 8,9,10,10,12-pentamethyl-1,12,15,17-tetrazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaene |
| SMILES | CC1c2ccccc2N2c3ncncc3N(C)C2C(C)(C)C1C |
| InChI | InChI=1S/C19H24N4/c1-12-13(2)19(3,4)18-22(5)16-10-20-11-21-17(16)23(18)15-9-7-6-8-14(12)15/h6-13,18H,1-5H3 |
| InChIKey | CKRYRYIUPHAKOE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |