C10H9F2N3O2S2 — CID 145285653
4-ethyl-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 145285653) has the molecular formula C10H9F2N3O2S2 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-ethyl-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-ethyl-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 145285653 |
| Molecular Formula | C10H9F2N3O2S2 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-ethyl-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CCc1cc(F)c(S(=O)(=O)Nc2ncns2)cc1F |
| InChI | InChI=1S/C10H9F2N3O2S2/c1-2-6-3-8(12)9(4-7(6)11)19(16,17)15-10-13-5-14-18-10/h3-5H,2H2,1H3,(H,13,14,15) |
| InChIKey | GPJLLAROJDREEP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |