C15H25F3N2O — CID 145287074
2-methyl-1-[4-[3-(trifluoromethyl)piperidin-1-yl]piperidin-1-yl]propan-1-one (PubChem CID 145287074) has the molecular formula C15H25F3N2O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-methyl-1-[4-[3-(trifluoromethyl)piperidin-1-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[3-(trifluoromethyl)piperidin-1-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 145287074 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-methyl-1-[4-[3-(trifluoromethyl)piperidin-1-yl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCC(N2CCCC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C15H25F3N2O/c1-11(2)14(21)19-8-5-13(6-9-19)20-7-3-4-12(10-20)15(16,17)18/h11-13H,3-10H2,1-2H3 |
| InChIKey | FVBVKHHUMJNION-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |